C16H32O5Si — CID 87206561
(3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-methoxycarbonyl-5,5-dimethylhexanoic acid (PubChem CID 87206561) has the molecular formula C16H32O5Si and a molecular weight of 332.51 g/mol. Its IUPAC name is (3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-methoxycarbonyl-5,5-dimethylhexanoic acid.
| Compound Name | (3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-methoxycarbonyl-5,5-dimethylhexanoic acid |
|---|---|
| PubChem CID | 87206561 |
| Molecular Formula | C16H32O5Si |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | (3R)-3-[tert-butyl(dimethyl)silyl]oxy-4-methoxycarbonyl-5,5-dimethylhexanoic acid |
| SMILES | COC(=O)C([C@@H](CC(=O)O)O[Si](C)(C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C16H32O5Si/c1-15(2,3)13(14(19)20-7)11(10-12(17)18)21-22(8,9)16(4,5)6/h11,13H,10H2,1-9H3,(H,17,18)/t11-,13?/m1/s1 |
| InChIKey | MXTSWSYSDCLSRN-JTDNENJMSA-N |
| XLogP | 3.69 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|