(3S,4R)-4,5-dimethyl-3-tri(propan-2-yl)silyloxyhexanoic acid

C17H36O3Si — CID 58901321

IUPAC(3S,4R)-4,5-dimethyl-3-tri(propan-2-yl)silyloxyhexanoic acid
SMILESCC(C)[C@@H](C)[C@H](CC(=O)O)O[Si](C(C)C)(C(C)C)C(C)C
InChIInChI=1S/C17H36O3Si/c1-11(2)15(9)16(10-17(18)19)20-21(12(3)4,13(5)6)14(7)8/h11-16H,10H2,1-9H3,(H,18,19)/t15-,16+/m1/s1
InChIKeyYBEJLOWYTYQZDG-CVEARBPZSA-N
MW316.56 g/mol
LogP5.31
Rot. Bonds9

About (3S,4R)-4,5-dimethyl-3-tri(propan-2-yl)silyloxyhexanoic acid

(3S,4R)-4,5-dimethyl-3-tri(propan-2-yl)silyloxyhexanoic acid (PubChem CID 58901321) has the molecular formula C17H36O3Si and a molecular weight of 316.56 g/mol. Its IUPAC name is (3S,4R)-4,5-dimethyl-3-tri(propan-2-yl)silyloxyhexanoic acid.

Molecular Properties

Compound Name(3S,4R)-4,5-dimethyl-3-tri(propan-2-yl)silyloxyhexanoic acid
PubChem CID58901321
Molecular FormulaC17H36O3Si
Molecular Weight316.56 g/mol
Exact Mass316.24
IUPAC Name(3S,4R)-4,5-dimethyl-3-tri(propan-2-yl)silyloxyhexanoic acid
SMILESCC(C)[C@@H](C)[C@H](CC(=O)O)O[Si](C(C)C)(C(C)C)C(C)C
InChIInChI=1S/C17H36O3Si/c1-11(2)15(9)16(10-17(18)19)20-21(12(3)4,13(5)6)14(7)8/h11-16H,10H2,1-9H3,(H,18,19)/t15-,16+/m1/s1
InChIKeyYBEJLOWYTYQZDG-CVEARBPZSA-N
XLogP5.31
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds9
Heavy Atoms21
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500316.56
LogP ≤ 55.31
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (3S,4R)-4,5-dimethyl-3-tri(propan-2-yl)silyloxyhexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3S,4R)-4,5-dimethyl-3-tri(propan-2-yl)silyloxyhexanoic acid?
The IUPAC name of (3S,4R)-4,5-dimethyl-3-tri(propan-2-yl)silyloxyhexanoic acid (CID 58901321) is (3S,4R)-4,5-dimethyl-3-tri(propan-2-yl)silyloxyhexanoic acid.
What is the SMILES notation for (3S,4R)-4,5-dimethyl-3-tri(propan-2-yl)silyloxyhexanoic acid?
The canonical SMILES for (3S,4R)-4,5-dimethyl-3-tri(propan-2-yl)silyloxyhexanoic acid is CC(C)[C@@H](C)[C@H](CC(=O)O)O[Si](C(C)C)(C(C)C)C(C)C.
What is the InChIKey of (3S,4R)-4,5-dimethyl-3-tri(propan-2-yl)silyloxyhexanoic acid?
The InChIKey is YBEJLOWYTYQZDG-CVEARBPZSA-N. The full InChI is InChI=1S/C17H36O3Si/c1-11(2)15(9)16(10-17(18)19)20-21(12(3)4,13(5)6)14(7)8/h11-16H,10H2,1-9H3,(H,18,19)/t15-,16+/m1/s1.
What are the key properties of (3S,4R)-4,5-dimethyl-3-tri(propan-2-yl)silyloxyhexanoic acid?
(3S,4R)-4,5-dimethyl-3-tri(propan-2-yl)silyloxyhexanoic acid has a molecular weight of 316.56 g/mol, XLogP of 5.31, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4R)-4,5-dimethyl-3-tri(propan-2-yl)silyloxyhexanoic acid is sourced from PubChem (CID 58901321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).