C17H36O3Si — CID 58901321
(3S,4R)-4,5-dimethyl-3-tri(propan-2-yl)silyloxyhexanoic acid (PubChem CID 58901321) has the molecular formula C17H36O3Si and a molecular weight of 316.56 g/mol. Its IUPAC name is (3S,4R)-4,5-dimethyl-3-tri(propan-2-yl)silyloxyhexanoic acid.
| Compound Name | (3S,4R)-4,5-dimethyl-3-tri(propan-2-yl)silyloxyhexanoic acid |
|---|---|
| PubChem CID | 58901321 |
| Molecular Formula | C17H36O3Si |
| Molecular Weight | 316.56 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | (3S,4R)-4,5-dimethyl-3-tri(propan-2-yl)silyloxyhexanoic acid |
| SMILES | CC(C)[C@@H](C)[C@H](CC(=O)O)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C17H36O3Si/c1-11(2)15(9)16(10-17(18)19)20-21(12(3)4,13(5)6)14(7)8/h11-16H,10H2,1-9H3,(H,18,19)/t15-,16+/m1/s1 |
| InChIKey | YBEJLOWYTYQZDG-CVEARBPZSA-N |
| XLogP | 5.31 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.56 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|