About bis(phosphanyl)phosphane;methyl 2-(5-bromo-2-ethyl-3-fluorophenyl)sulfanylacetate
bis(phosphanyl)phosphane;methyl 2-(5-bromo-2-ethyl-3-fluorophenyl)sulfanylacetate (PubChem CID 159368094) has the molecular formula C11H17BrFO2P3S
and a molecular weight of 405.15 g/mol. Its IUPAC name is bis(phosphanyl)phosphane;methyl 2-(5-bromo-2-ethyl-3-fluorophenyl)sulfanylacetate.
Molecular Properties
| Compound Name | bis(phosphanyl)phosphane;methyl 2-(5-bromo-2-ethyl-3-fluorophenyl)sulfanylacetate |
| PubChem CID | 159368094 |
| Molecular Formula | C11H17BrFO2P3S |
| Molecular Weight | 405.15 g/mol |
| Exact Mass | 403.93 |
| IUPAC Name | bis(phosphanyl)phosphane;methyl 2-(5-bromo-2-ethyl-3-fluorophenyl)sulfanylacetate |
| SMILES | CCc1c(F)cc(Br)cc1SCC(=O)OC.PPP |
| InChI | InChI=1S/C11H12BrFO2S.H5P3/c1-3-8-9(13)4-7(12)5-10(8)16-6-11(14)15-2;1-3-2/h4-5H,3,6H2,1-2H3;3H,1-2H2 |
| InChIKey | LJJPZHJWGRXBDE-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.15 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(phosphanyl)phosphane;methyl 2-(5-bromo-2-ethyl-3-fluorophenyl)sulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(phosphanyl)phosphane;methyl 2-(5-bromo-2-ethyl-3-fluorophenyl)sulfanylacetate?
The IUPAC name of bis(phosphanyl)phosphane;methyl 2-(5-bromo-2-ethyl-3-fluorophenyl)sulfanylacetate (CID 159368094) is bis(phosphanyl)phosphane;methyl 2-(5-bromo-2-ethyl-3-fluorophenyl)sulfanylacetate.
What is the SMILES notation for bis(phosphanyl)phosphane;methyl 2-(5-bromo-2-ethyl-3-fluorophenyl)sulfanylacetate?
The canonical SMILES for bis(phosphanyl)phosphane;methyl 2-(5-bromo-2-ethyl-3-fluorophenyl)sulfanylacetate is CCc1c(F)cc(Br)cc1SCC(=O)OC.PPP.
What is the InChIKey of bis(phosphanyl)phosphane;methyl 2-(5-bromo-2-ethyl-3-fluorophenyl)sulfanylacetate?
The InChIKey is LJJPZHJWGRXBDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12BrFO2S.H5P3/c1-3-8-9(13)4-7(12)5-10(8)16-6-11(14)15-2;1-3-2/h4-5H,3,6H2,1-2H3;3H,1-2H2.
What are the key properties of bis(phosphanyl)phosphane;methyl 2-(5-bromo-2-ethyl-3-fluorophenyl)sulfanylacetate?
bis(phosphanyl)phosphane;methyl 2-(5-bromo-2-ethyl-3-fluorophenyl)sulfanylacetate has a molecular weight of 405.15 g/mol, XLogP of 4.66, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(phosphanyl)phosphane;methyl 2-(5-bromo-2-ethyl-3-fluorophenyl)sulfanylacetate is sourced from PubChem (CID 159368094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).