C39H36F6O7S — CID 159369987
(6-oxo-8-propyl-7,8,9,10-tetrahydrobenzo[c]chromen-3-yl) trifluoromethanesulfonate;8-propyl-3-(3,4,5-trifluorophenyl)-7,8,9,10-tetrahydrobenzo[c]chromen-6-one (PubChem CID 159369987) has the molecular formula C39H36F6O7S and a molecular weight of 762.77 g/mol. Its IUPAC name is (6-oxo-8-propyl-7,8,9,10-tetrahydrobenzo[c]chromen-3-yl) trifluoromethanesulfonate;8-propyl-3-(3,4,5-trifluorophenyl)-7,8,9,10-tetrahydrobenzo[c]chromen-6-one.
| Compound Name | (6-oxo-8-propyl-7,8,9,10-tetrahydrobenzo[c]chromen-3-yl) trifluoromethanesulfonate;8-propyl-3-(3,4,5-trifluorophenyl)-7,8,9,10-tetrahydrobenzo[c]chromen-6-one |
|---|---|
| PubChem CID | 159369987 |
| Molecular Formula | C39H36F6O7S |
| Molecular Weight | 762.77 g/mol |
| Exact Mass | 762.21 |
| IUPAC Name | (6-oxo-8-propyl-7,8,9,10-tetrahydrobenzo[c]chromen-3-yl) trifluoromethanesulfonate;8-propyl-3-(3,4,5-trifluorophenyl)-7,8,9,10-tetrahydrobenzo[c]chromen-6-one |
| SMILES | CCCC1CCc2c(c(=O)oc3cc(-c4cc(F)c(F)c(F)c4)ccc23)C1.CCCC1CCc2c(c(=O)oc3cc(OS(=O)(=O)C(F)(F)F)ccc23)C1 |
| InChI | InChI=1S/C22H19F3O2.C17H17F3O5S/c1-2-3-12-4-6-15-16-7-5-13(11-20(16)27-22(26)17(15)8-12)14-9-18(23)21(25)19(24)10-14;1-2-3-10-4-6-12-13-7-5-11(25-26(22,23)17(18,19)20)9-15(13)24-16(21)14(12)8-10/h5,7,9-12H,2-4,6,8H2,1H3;5,7,9-10H,2-4,6,8H2,1H3 |
| InChIKey | LJPQDSPKTCYUJE-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 103.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.77 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|