C30H38N2O8 — CID 159370599
ethyl 3-[2-(2-hydroxyethylcarbamoyl)phenyl]-2-methylprop-2-enoate (PubChem CID 159370599) has the molecular formula C30H38N2O8 and a molecular weight of 554.64 g/mol. Its IUPAC name is ethyl 3-[2-(2-hydroxyethylcarbamoyl)phenyl]-2-methylprop-2-enoate.
| Compound Name | ethyl 3-[2-(2-hydroxyethylcarbamoyl)phenyl]-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 159370599 |
| Molecular Formula | C30H38N2O8 |
| Molecular Weight | 554.64 g/mol |
| Exact Mass | 554.26 |
| IUPAC Name | ethyl 3-[2-(2-hydroxyethylcarbamoyl)phenyl]-2-methylprop-2-enoate |
| SMILES | CCOC(=O)C(C)=Cc1ccccc1C(=O)NCCO.CCOC(=O)C(C)=Cc1ccccc1C(=O)NCCO |
| InChI | InChI=1S/2C15H19NO4/c2*1-3-20-15(19)11(2)10-12-6-4-5-7-13(12)14(18)16-8-9-17/h2*4-7,10,17H,3,8-9H2,1-2H3,(H,16,18) |
| InChIKey | LJRPHSOVXDDOAT-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.64 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|