C30H40F2O4S2 — CID 159371138
2-(1-adamantyl)-1,1-difluoroethanesulfonic acid;2-(4-butoxynaphthalen-1-yl)thiolane (PubChem CID 159371138) has the molecular formula C30H40F2O4S2 and a molecular weight of 566.78 g/mol. Its IUPAC name is 2-(1-adamantyl)-1,1-difluoroethanesulfonic acid;2-(4-butoxynaphthalen-1-yl)thiolane.
| Compound Name | 2-(1-adamantyl)-1,1-difluoroethanesulfonic acid;2-(4-butoxynaphthalen-1-yl)thiolane |
|---|---|
| PubChem CID | 159371138 |
| Molecular Formula | C30H40F2O4S2 |
| Molecular Weight | 566.78 g/mol |
| Exact Mass | 566.23 |
| IUPAC Name | 2-(1-adamantyl)-1,1-difluoroethanesulfonic acid;2-(4-butoxynaphthalen-1-yl)thiolane |
| SMILES | CCCCOc1ccc(C2CCCS2)c2ccccc12.O=S(=O)(O)C(F)(F)CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C18H22OS.C12H18F2O3S/c1-2-3-12-19-17-11-10-16(18-9-6-13-20-18)14-7-4-5-8-15(14)17;13-12(14,18(15,16)17)7-11-4-8-1-9(5-11)3-10(2-8)6-11/h4-5,7-8,10-11,18H,2-3,6,9,12-13H2,1H3;8-10H,1-7H2,(H,15,16,17) |
| InChIKey | LJTKBJQHIIPFMD-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.78 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|