C23H19N3O4W2-2 — CID 159374531
benzamide;ethyl 4-(2-phenyl-1,3-oxazol-4-yl)-1H-pyrrole-2-carboxylate;tungsten (PubChem CID 159374531) has the molecular formula C23H19N3O4W2-2 and a molecular weight of 769.10 g/mol. Its IUPAC name is benzamide;ethyl 4-(2-phenyl-1,3-oxazol-4-yl)-1H-pyrrole-2-carboxylate;tungsten.
| Compound Name | benzamide;ethyl 4-(2-phenyl-1,3-oxazol-4-yl)-1H-pyrrole-2-carboxylate;tungsten |
|---|---|
| PubChem CID | 159374531 |
| Molecular Formula | C23H19N3O4W2-2 |
| Molecular Weight | 769.10 g/mol |
| Exact Mass | 769.04 |
| IUPAC Name | benzamide;ethyl 4-(2-phenyl-1,3-oxazol-4-yl)-1H-pyrrole-2-carboxylate;tungsten |
| SMILES | CCOC(=O)c1cc(-c2coc(-c3c[c-]ccc3)n2)c[nH]1.NC(=O)c1c[c-]ccc1.[W].[W] |
| InChI | InChI=1S/C16H13N2O3.C7H6NO.2W/c1-2-20-16(19)13-8-12(9-17-13)14-10-21-15(18-14)11-6-4-3-5-7-11;8-7(9)6-4-2-1-3-5-6;;/h3-4,6-10,17H,2H2,1H3;1-2,4-5H,(H2,8,9);;/q2*-1;; |
| InChIKey | BUKMDVSLLWXALA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.10 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|