C16H13N7O3 — CID 169343309
ethyl 2-[4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]-1,3-oxazole-4-carboxylate (PubChem CID 169343309) has the molecular formula C16H13N7O3 and a molecular weight of 351.33 g/mol. Its IUPAC name is ethyl 2-[4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]-1,3-oxazole-4-carboxylate.
| Compound Name | ethyl 2-[4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 169343309 |
| Molecular Formula | C16H13N7O3 |
| Molecular Weight | 351.33 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | ethyl 2-[4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]phenyl]-1,3-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1coc(-c2ccc(NC=C(C#N)c3nn[nH]n3)cc2)n1 |
| InChI | InChI=1S/C16H13N7O3/c1-2-25-16(24)13-9-26-15(19-13)10-3-5-12(6-4-10)18-8-11(7-17)14-20-22-23-21-14/h3-6,8-9,18H,2H2,1H3,(H,20,21,22,23) |
| InChIKey | DJZVQQAMAVFZMR-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 142.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.33 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|