C19H15N7O — CID 169344471
3-[[7-methyl-2-(4-methylphenyl)-1,3-benzoxazol-5-yl]amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169344471) has the molecular formula C19H15N7O and a molecular weight of 357.38 g/mol. Its IUPAC name is 3-[[7-methyl-2-(4-methylphenyl)-1,3-benzoxazol-5-yl]amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[[7-methyl-2-(4-methylphenyl)-1,3-benzoxazol-5-yl]amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169344471 |
| Molecular Formula | C19H15N7O |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 3-[[7-methyl-2-(4-methylphenyl)-1,3-benzoxazol-5-yl]amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | Cc1ccc(-c2nc3cc(NC=C(C#N)c4nn[nH]n4)cc(C)c3o2)cc1 |
| InChI | InChI=1S/C19H15N7O/c1-11-3-5-13(6-4-11)19-22-16-8-15(7-12(2)17(16)27-19)21-10-14(9-20)18-23-25-26-24-18/h3-8,10,21H,1-2H3,(H,23,24,25,26) |
| InChIKey | IRIADFOGGAQYQN-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 116.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|