C13H9N7O — CID 169346886
3-[(3-hydroxyquinolin-7-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169346886) has the molecular formula C13H9N7O and a molecular weight of 279.26 g/mol. Its IUPAC name is 3-[(3-hydroxyquinolin-7-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[(3-hydroxyquinolin-7-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169346886 |
| Molecular Formula | C13H9N7O |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 3-[(3-hydroxyquinolin-7-yl)amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | N#CC(=CNc1ccc2cc(O)cnc2c1)c1nn[nH]n1 |
| InChI | InChI=1S/C13H9N7O/c14-5-9(13-17-19-20-18-13)6-15-10-2-1-8-3-11(21)7-16-12(8)4-10/h1-4,6-7,15,21H,(H,17,18,19,20) |
| InChIKey | AIFPWZGGHDAZDO-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 123.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|