C17H9Cl2N7O — CID 169345087
3-[[2-(3,4-dichlorophenyl)-1,3-benzoxazol-5-yl]amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169345087) has the molecular formula C17H9Cl2N7O and a molecular weight of 398.21 g/mol. Its IUPAC name is 3-[[2-(3,4-dichlorophenyl)-1,3-benzoxazol-5-yl]amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[[2-(3,4-dichlorophenyl)-1,3-benzoxazol-5-yl]amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169345087 |
| Molecular Formula | C17H9Cl2N7O |
| Molecular Weight | 398.21 g/mol |
| Exact Mass | 397.02 |
| IUPAC Name | 3-[[2-(3,4-dichlorophenyl)-1,3-benzoxazol-5-yl]amino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | N#CC(=CNc1ccc2oc(-c3ccc(Cl)c(Cl)c3)nc2c1)c1nn[nH]n1 |
| InChI | InChI=1S/C17H9Cl2N7O/c18-12-3-1-9(5-13(12)19)17-22-14-6-11(2-4-15(14)27-17)21-8-10(7-20)16-23-25-26-24-16/h1-6,8,21H,(H,23,24,25,26) |
| InChIKey | WRLHSEJBILNXSZ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 116.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.21 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|