C22H14N6O — CID 169342585
3-(4-dibenzofuran-4-ylanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169342585) has the molecular formula C22H14N6O and a molecular weight of 378.40 g/mol. Its IUPAC name is 3-(4-dibenzofuran-4-ylanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-(4-dibenzofuran-4-ylanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169342585 |
| Molecular Formula | C22H14N6O |
| Molecular Weight | 378.40 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 3-(4-dibenzofuran-4-ylanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | N#CC(=CNc1ccc(-c2cccc3c2oc2ccccc23)cc1)c1nn[nH]n1 |
| InChI | InChI=1S/C22H14N6O/c23-12-15(22-25-27-28-26-22)13-24-16-10-8-14(9-11-16)17-5-3-6-19-18-4-1-2-7-20(18)29-21(17)19/h1-11,13,24H,(H,25,26,27,28) |
| InChIKey | YFKUDJYBQHKRHG-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 103.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.40 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|