C13H13N5O4 — CID 159374839
5-[[2-(2-amino-4-hydroxy-6-imino-3H-pyridin-5-yl)acetyl]amino]pyridine-2-carboxylic acid (PubChem CID 159374839) has the molecular formula C13H13N5O4 and a molecular weight of 303.28 g/mol. Its IUPAC name is 5-[[2-(2-amino-4-hydroxy-6-imino-3H-pyridin-5-yl)acetyl]amino]pyridine-2-carboxylic acid.
| Compound Name | 5-[[2-(2-amino-4-hydroxy-6-imino-3H-pyridin-5-yl)acetyl]amino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 159374839 |
| Molecular Formula | C13H13N5O4 |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 5-[[2-(2-amino-4-hydroxy-6-imino-3H-pyridin-5-yl)acetyl]amino]pyridine-2-carboxylic acid |
| SMILES | [H]/N=C1\N=C(N)CC(O)=C1CC(=O)Nc1ccc(C(=O)O)nc1 |
| InChI | InChI=1S/C13H13N5O4/c14-10-4-9(19)7(12(15)18-10)3-11(20)17-6-1-2-8(13(21)22)16-5-6/h1-2,5,19H,3-4H2,(H,17,20)(H,21,22)(H3,14,15,18) |
| InChIKey | LJUBBGHOKDDAOG-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 161.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|