C23H30N2O2S2 — CID 159385953
ethyl 4-cyano-5-methyl-4-thiophen-2-ylhexanoate;3-methyl-2-thiophen-2-ylbutanenitrile (PubChem CID 159385953) has the molecular formula C23H30N2O2S2 and a molecular weight of 430.64 g/mol. Its IUPAC name is ethyl 4-cyano-5-methyl-4-thiophen-2-ylhexanoate;3-methyl-2-thiophen-2-ylbutanenitrile.
| Compound Name | ethyl 4-cyano-5-methyl-4-thiophen-2-ylhexanoate;3-methyl-2-thiophen-2-ylbutanenitrile |
|---|---|
| PubChem CID | 159385953 |
| Molecular Formula | C23H30N2O2S2 |
| Molecular Weight | 430.64 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | ethyl 4-cyano-5-methyl-4-thiophen-2-ylhexanoate;3-methyl-2-thiophen-2-ylbutanenitrile |
| SMILES | CC(C)C(C#N)c1cccs1.CCOC(=O)CCC(C#N)(c1cccs1)C(C)C |
| InChI | InChI=1S/C14H19NO2S.C9H11NS/c1-4-17-13(16)7-8-14(10-15,11(2)3)12-6-5-9-18-12;1-7(2)8(6-10)9-4-3-5-11-9/h5-6,9,11H,4,7-8H2,1-3H3;3-5,7-8H,1-2H3 |
| InChIKey | LLMNHZLZIVTKKW-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 73.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.64 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |