C12H15NO2S — CID 20800700
(4S)-4-cyano-5-methyl-4-thiophen-3-ylhexanoic acid (PubChem CID 20800700) has the molecular formula C12H15NO2S and a molecular weight of 237.32 g/mol. Its IUPAC name is (4S)-4-cyano-5-methyl-4-thiophen-3-ylhexanoic acid.
| Compound Name | (4S)-4-cyano-5-methyl-4-thiophen-3-ylhexanoic acid |
|---|---|
| PubChem CID | 20800700 |
| Molecular Formula | C12H15NO2S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | (4S)-4-cyano-5-methyl-4-thiophen-3-ylhexanoic acid |
| SMILES | CC(C)[C@@](C#N)(CCC(=O)O)c1ccsc1 |
| InChI | InChI=1S/C12H15NO2S/c1-9(2)12(8-13,5-3-11(14)15)10-4-6-16-7-10/h4,6-7,9H,3,5H2,1-2H3,(H,14,15)/t12-/m0/s1 |
| InChIKey | CWMIHLKMNANBDH-LBPRGKRZSA-N |
| XLogP | 3.03 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |