C23H25BrN2O2 — CID 159386229
2-bromo-5-methylpyridine;1-(5-methyl-2-pyridinyl)-2-(2,3,5-trimethylphenoxy)ethanone (PubChem CID 159386229) has the molecular formula C23H25BrN2O2 and a molecular weight of 441.37 g/mol. Its IUPAC name is 2-bromo-5-methylpyridine;1-(5-methyl-2-pyridinyl)-2-(2,3,5-trimethylphenoxy)ethanone.
| Compound Name | 2-bromo-5-methylpyridine;1-(5-methyl-2-pyridinyl)-2-(2,3,5-trimethylphenoxy)ethanone |
|---|---|
| PubChem CID | 159386229 |
| Molecular Formula | C23H25BrN2O2 |
| Molecular Weight | 441.37 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | 2-bromo-5-methylpyridine;1-(5-methyl-2-pyridinyl)-2-(2,3,5-trimethylphenoxy)ethanone |
| SMILES | Cc1ccc(Br)nc1.Cc1ccc(C(=O)COc2cc(C)cc(C)c2C)nc1 |
| InChI | InChI=1S/C17H19NO2.C6H6BrN/c1-11-5-6-15(18-9-11)16(19)10-20-17-8-12(2)7-13(3)14(17)4;1-5-2-3-6(7)8-4-5/h5-9H,10H2,1-4H3;2-4H,1H3 |
| InChIKey | LLNJIRQWHWEPHT-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.37 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|