C17H23NO2 — CID 78767913
N,N-bis(prop-2-enyl)-2-(2,3,5-trimethylphenoxy)acetamide (PubChem CID 78767913) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is N,N-bis(prop-2-enyl)-2-(2,3,5-trimethylphenoxy)acetamide.
| Compound Name | N,N-bis(prop-2-enyl)-2-(2,3,5-trimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 78767913 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | N,N-bis(prop-2-enyl)-2-(2,3,5-trimethylphenoxy)acetamide |
| SMILES | C=CCN(CC=C)C(=O)COc1cc(C)cc(C)c1C |
| InChI | InChI=1S/C17H23NO2/c1-6-8-18(9-7-2)17(19)12-20-16-11-13(3)10-14(4)15(16)5/h6-7,10-11H,1-2,8-9,12H2,3-5H3 |
| InChIKey | LVJXVEXMYYEPFF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|