C34H44Br2N6O5 — CID 159390174
4-[(3-amino-6-bromoquinolin-4-yl)amino]-1-methylcyclohexan-1-ol;4-[(6-bromo-3-nitroquinolin-4-yl)amino]-1-methylcyclohexan-1-ol;ethanol (PubChem CID 159390174) has the molecular formula C34H44Br2N6O5 and a molecular weight of 776.57 g/mol. Its IUPAC name is 4-[(3-amino-6-bromoquinolin-4-yl)amino]-1-methylcyclohexan-1-ol;4-[(6-bromo-3-nitroquinolin-4-yl)amino]-1-methylcyclohexan-1-ol;ethanol.
| Compound Name | 4-[(3-amino-6-bromoquinolin-4-yl)amino]-1-methylcyclohexan-1-ol;4-[(6-bromo-3-nitroquinolin-4-yl)amino]-1-methylcyclohexan-1-ol;ethanol |
|---|---|
| PubChem CID | 159390174 |
| Molecular Formula | C34H44Br2N6O5 |
| Molecular Weight | 776.57 g/mol |
| Exact Mass | 774.17 |
| IUPAC Name | 4-[(3-amino-6-bromoquinolin-4-yl)amino]-1-methylcyclohexan-1-ol;4-[(6-bromo-3-nitroquinolin-4-yl)amino]-1-methylcyclohexan-1-ol;ethanol |
| SMILES | CC1(O)CCC(Nc2c(N)cnc3ccc(Br)cc23)CC1.CC1(O)CCC(Nc2c([N+](=O)[O-])cnc3ccc(Br)cc23)CC1.CCO |
| InChI | InChI=1S/C16H18BrN3O3.C16H20BrN3O.C2H6O/c1-16(21)6-4-11(5-7-16)19-15-12-8-10(17)2-3-13(12)18-9-14(15)20(22)23;1-16(21)6-4-11(5-7-16)20-15-12-8-10(17)2-3-14(12)19-9-13(15)18;1-2-3/h2-3,8-9,11,21H,4-7H2,1H3,(H,18,19);2-3,8-9,11,21H,4-7,18H2,1H3,(H,19,20);3H,2H2,1H3 |
| InChIKey | LLZXOLVOHHHNIL-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 179.69 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.57 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|