C22H22N6O — CID 159390213
N',N',8-trimethyl-2-(4-methylphenyl)-9-phenylpurine-6-carbohydrazide (PubChem CID 159390213) has the molecular formula C22H22N6O and a molecular weight of 386.46 g/mol. Its IUPAC name is N',N',8-trimethyl-2-(4-methylphenyl)-9-phenylpurine-6-carbohydrazide.
| Compound Name | N',N',8-trimethyl-2-(4-methylphenyl)-9-phenylpurine-6-carbohydrazide |
|---|---|
| PubChem CID | 159390213 |
| Molecular Formula | C22H22N6O |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | N',N',8-trimethyl-2-(4-methylphenyl)-9-phenylpurine-6-carbohydrazide |
| SMILES | Cc1ccc(-c2nc(C(=O)NN(C)C)c3nc(C)n(-c4ccccc4)c3n2)cc1 |
| InChI | InChI=1S/C22H22N6O/c1-14-10-12-16(13-11-14)20-24-19(22(29)26-27(3)4)18-21(25-20)28(15(2)23-18)17-8-6-5-7-9-17/h5-13H,1-4H3,(H,26,29) |
| InChIKey | NVETYUABNCFNOH-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|