C14H27O14P2-3 — CID 159393563
[(E)-4-hydroxy-5-methoxy-1-oxidopent-1-en-3-yl] methyl phosphate;(Z)-4-hydroxy-5-methoxypent-2-enal;methyl hydrogen phosphate (PubChem CID 159393563) has the molecular formula C14H27O14P2-3 and a molecular weight of 481.30 g/mol. Its IUPAC name is [(E)-4-hydroxy-5-methoxy-1-oxidopent-1-en-3-yl] methyl phosphate;(Z)-4-hydroxy-5-methoxypent-2-enal;methyl hydrogen phosphate.
| Compound Name | [(E)-4-hydroxy-5-methoxy-1-oxidopent-1-en-3-yl] methyl phosphate;(Z)-4-hydroxy-5-methoxypent-2-enal;methyl hydrogen phosphate |
|---|---|
| PubChem CID | 159393563 |
| Molecular Formula | C14H27O14P2-3 |
| Molecular Weight | 481.30 g/mol |
| Exact Mass | 481.09 |
| IUPAC Name | [(E)-4-hydroxy-5-methoxy-1-oxidopent-1-en-3-yl] methyl phosphate;(Z)-4-hydroxy-5-methoxypent-2-enal;methyl hydrogen phosphate |
| SMILES | COCC(O)/C=C\C=O.COCC(O)C(/C=C/[O-])OP(=O)([O-])OC.COP(=O)([O-])O |
| InChI | InChI=1S/C7H15O7P.C6H10O3.CH5O4P/c1-12-5-6(9)7(3-4-8)14-15(10,11)13-2;1-9-5-6(8)3-2-4-7;1-5-6(2,3)4/h3-4,6-9H,5H2,1-2H3,(H,10,11);2-4,6,8H,5H2,1H3;1H3,(H2,2,3,4)/p-3/b4-3+;3-2-; |
| InChIKey | LMKSPPHZUZIBRW-OGCIOXKDSA-K |
| XLogP | -2.79 |
| TPSA | 227.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.30 |
| LogP ≤ 5 | -2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|