C28H49O10P — CID 134812515
[(2R)-2-[(E)-4-hydroxy-7-oxohept-5-enoyl]oxy-3-phosphonooxypropyl] (Z)-octadec-9-enoate (PubChem CID 134812515) has the molecular formula C28H49O10P and a molecular weight of 576.66 g/mol. Its IUPAC name is [(2R)-2-[(E)-4-hydroxy-7-oxohept-5-enoyl]oxy-3-phosphonooxypropyl] (Z)-octadec-9-enoate.
| Compound Name | [(2R)-2-[(E)-4-hydroxy-7-oxohept-5-enoyl]oxy-3-phosphonooxypropyl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 134812515 |
| Molecular Formula | C28H49O10P |
| Molecular Weight | 576.66 g/mol |
| Exact Mass | 576.31 |
| IUPAC Name | [(2R)-2-[(E)-4-hydroxy-7-oxohept-5-enoyl]oxy-3-phosphonooxypropyl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)(O)O)OC(=O)CCC(O)/C=C/C=O |
| InChI | InChI=1S/C28H49O10P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-27(31)36-23-26(24-37-39(33,34)35)38-28(32)21-20-25(30)18-17-22-29/h9-10,17-18,22,25-26,30H,2-8,11-16,19-21,23-24H2,1H3,(H2,33,34,35)/b10-9-,18-17+/t25?,26-/m1/s1 |
| InChIKey | YPUMXOJPZSOXNO-OFUPOGHISA-N |
| XLogP | 5.48 |
| TPSA | 156.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.66 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|