C35H65O8P — CID 134739523
[(2R)-3-phosphonooxy-2-[(E)-tetradec-9-enoyl]oxypropyl] (E)-octadec-11-enoate (PubChem CID 134739523) has the molecular formula C35H65O8P and a molecular weight of 644.87 g/mol. Its IUPAC name is [(2R)-3-phosphonooxy-2-[(E)-tetradec-9-enoyl]oxypropyl] (E)-octadec-11-enoate.
| Compound Name | [(2R)-3-phosphonooxy-2-[(E)-tetradec-9-enoyl]oxypropyl] (E)-octadec-11-enoate |
|---|---|
| PubChem CID | 134739523 |
| Molecular Formula | C35H65O8P |
| Molecular Weight | 644.87 g/mol |
| Exact Mass | 644.44 |
| IUPAC Name | [(2R)-3-phosphonooxy-2-[(E)-tetradec-9-enoyl]oxypropyl] (E)-octadec-11-enoate |
| SMILES | CCCC/C=C/CCCCCCCC(=O)O[C@H](COC(=O)CCCCCCCCC/C=C/CCCCCC)COP(=O)(O)O |
| InChI | InChI=1S/C35H65O8P/c1-3-5-7-9-11-13-15-16-17-18-20-21-23-25-27-29-34(36)41-31-33(32-42-44(38,39)40)43-35(37)30-28-26-24-22-19-14-12-10-8-6-4-2/h10,12-13,15,33H,3-9,11,14,16-32H2,1-2H3,(H2,38,39,40)/b12-10+,15-13+/t33-/m1/s1 |
| InChIKey | IUXWCJRCWVVTDA-CWLUQWBFSA-N |
| XLogP | 10.07 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.87 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|