C32H59O8P — CID 52928755
[(2R)-3-phosphonooxy-2-[(Z)-tetradec-9-enoyl]oxypropyl] (Z)-pentadec-9-enoate (PubChem CID 52928755) has the molecular formula C32H59O8P and a molecular weight of 602.79 g/mol. Its IUPAC name is [(2R)-3-phosphonooxy-2-[(Z)-tetradec-9-enoyl]oxypropyl] (Z)-pentadec-9-enoate.
| Compound Name | [(2R)-3-phosphonooxy-2-[(Z)-tetradec-9-enoyl]oxypropyl] (Z)-pentadec-9-enoate |
|---|---|
| PubChem CID | 52928755 |
| Molecular Formula | C32H59O8P |
| Molecular Weight | 602.79 g/mol |
| Exact Mass | 602.39 |
| IUPAC Name | [(2R)-3-phosphonooxy-2-[(Z)-tetradec-9-enoyl]oxypropyl] (Z)-pentadec-9-enoate |
| SMILES | CCCC/C=C\CCCCCCCC(=O)O[C@H](COC(=O)CCCCCCC/C=C\CCCCC)COP(=O)(O)O |
| InChI | InChI=1S/C32H59O8P/c1-3-5-7-9-11-13-15-17-18-20-22-24-26-31(33)38-28-30(29-39-41(35,36)37)40-32(34)27-25-23-21-19-16-14-12-10-8-6-4-2/h10-13,30H,3-9,14-29H2,1-2H3,(H2,35,36,37)/b12-10-,13-11-/t30-/m1/s1 |
| InChIKey | SNZJVUPGEOOWAQ-OLFVASKPSA-N |
| XLogP | 8.90 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.79 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|