C26H49O8P — CID 138290907
(1-nonanoyloxy-3-phosphonooxypropan-2-yl) (Z)-tetradec-9-enoate (PubChem CID 138290907) has the molecular formula C26H49O8P and a molecular weight of 520.64 g/mol. Its IUPAC name is (1-nonanoyloxy-3-phosphonooxypropan-2-yl) (Z)-tetradec-9-enoate.
| Compound Name | (1-nonanoyloxy-3-phosphonooxypropan-2-yl) (Z)-tetradec-9-enoate |
|---|---|
| PubChem CID | 138290907 |
| Molecular Formula | C26H49O8P |
| Molecular Weight | 520.64 g/mol |
| Exact Mass | 520.32 |
| IUPAC Name | (1-nonanoyloxy-3-phosphonooxypropan-2-yl) (Z)-tetradec-9-enoate |
| SMILES | CCCC/C=C\CCCCCCCC(=O)OC(COC(=O)CCCCCCCC)COP(=O)(O)O |
| InChI | InChI=1S/C26H49O8P/c1-3-5-7-9-11-12-13-14-15-17-19-21-26(28)34-24(23-33-35(29,30)31)22-32-25(27)20-18-16-10-8-6-4-2/h9,11,24H,3-8,10,12-23H2,1-2H3,(H2,29,30,31)/b11-9- |
| InChIKey | WQZFRFUXECXHCB-LUAWRHEFSA-N |
| XLogP | 6.78 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.64 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|