C33H61O8P — CID 134761180
[(2R)-3-phosphonooxy-2-[(E)-tetradec-9-enoyl]oxypropyl] (E)-hexadec-9-enoate (PubChem CID 134761180) has the molecular formula C33H61O8P and a molecular weight of 616.82 g/mol. Its IUPAC name is [(2R)-3-phosphonooxy-2-[(E)-tetradec-9-enoyl]oxypropyl] (E)-hexadec-9-enoate.
| Compound Name | [(2R)-3-phosphonooxy-2-[(E)-tetradec-9-enoyl]oxypropyl] (E)-hexadec-9-enoate |
|---|---|
| PubChem CID | 134761180 |
| Molecular Formula | C33H61O8P |
| Molecular Weight | 616.82 g/mol |
| Exact Mass | 616.41 |
| IUPAC Name | [(2R)-3-phosphonooxy-2-[(E)-tetradec-9-enoyl]oxypropyl] (E)-hexadec-9-enoate |
| SMILES | CCCC/C=C/CCCCCCCC(=O)O[C@H](COC(=O)CCCCCCC/C=C/CCCCCC)COP(=O)(O)O |
| InChI | InChI=1S/C33H61O8P/c1-3-5-7-9-11-13-15-16-18-19-21-23-25-27-32(34)39-29-31(30-40-42(36,37)38)41-33(35)28-26-24-22-20-17-14-12-10-8-6-4-2/h10,12-13,15,31H,3-9,11,14,16-30H2,1-2H3,(H2,36,37,38)/b12-10+,15-13+/t31-/m1/s1 |
| InChIKey | QKJBYEDABOQTKS-BLYSYRGISA-N |
| XLogP | 9.29 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.82 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|