C7H13O7P- — CID 58971764
CID 58971764 (PubChem CID 58971764) has the molecular formula C7H13O7P- and a molecular weight of 240.15 g/mol.
| Compound Name | CID 58971764 |
|---|---|
| PubChem CID | 58971764 |
| Molecular Formula | C7H13O7P- |
| Molecular Weight | 240.15 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | — |
| SMILES | COCC(O)C([CH]C=O)OP(=O)([O-])OC |
| InChI | InChI=1S/C7H14O7P/c1-12-5-6(9)7(3-4-8)14-15(10,11)13-2/h3-4,6-7,9H,5H2,1-2H3,(H,10,11)/p-1 |
| InChIKey | ASSMQCQWLPHGGD-UHFFFAOYSA-M |
| XLogP | -1.10 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.15 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|