C26H32N8O — CID 159394443
6,6-dimethyl-3-[(4-methyl-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)amino]-N-(2-phenylcyclopropyl)-1,4-dihydropyrrolo[3,4-c]pyrrole-5-carboxamide (PubChem CID 159394443) has the molecular formula C26H32N8O and a molecular weight of 472.60 g/mol. Its IUPAC name is 6,6-dimethyl-3-[(4-methyl-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)amino]-N-(2-phenylcyclopropyl)-1,4-dihydropyrrolo[3,4-c]pyrrole-5-carboxamide.
| Compound Name | 6,6-dimethyl-3-[(4-methyl-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)amino]-N-(2-phenylcyclopropyl)-1,4-dihydropyrrolo[3,4-c]pyrrole-5-carboxamide |
|---|---|
| PubChem CID | 159394443 |
| Molecular Formula | C26H32N8O |
| Molecular Weight | 472.60 g/mol |
| Exact Mass | 472.27 |
| IUPAC Name | 6,6-dimethyl-3-[(4-methyl-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)amino]-N-(2-phenylcyclopropyl)-1,4-dihydropyrrolo[3,4-c]pyrrole-5-carboxamide |
| SMILES | Cc1nc(NC2=NCC3=C2CN(C(=O)NC2CC2c2ccccc2)C3(C)C)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C26H32N8O/c1-16-28-23(32-24(29-16)33-11-7-8-12-33)31-22-19-15-34(26(2,3)20(19)14-27-22)25(35)30-21-13-18(21)17-9-5-4-6-10-17/h4-6,9-10,18,21H,7-8,11-15H2,1-3H3,(H,30,35)(H,27,28,29,31,32) |
| InChIKey | LMNMECHOPPQQGW-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 98.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.60 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |