C26H30N10O2 — CID 90654068
3-[[4-(2-cyanopyrrolidin-1-yl)-6-methoxy-1,3,5-triazin-2-yl]amino]-6,6-dimethyl-N-(2-phenylcyclopropyl)-1,4-dihydropyrrolo[3,4-d]pyrazole-5-carboxamide (PubChem CID 90654068) has the molecular formula C26H30N10O2 and a molecular weight of 514.59 g/mol. Its IUPAC name is 3-[[4-(2-cyanopyrrolidin-1-yl)-6-methoxy-1,3,5-triazin-2-yl]amino]-6,6-dimethyl-N-(2-phenylcyclopropyl)-1,4-dihydropyrrolo[3,4-d]pyrazole-5-carboxamide.
| Compound Name | 3-[[4-(2-cyanopyrrolidin-1-yl)-6-methoxy-1,3,5-triazin-2-yl]amino]-6,6-dimethyl-N-(2-phenylcyclopropyl)-1,4-dihydropyrrolo[3,4-d]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 90654068 |
| Molecular Formula | C26H30N10O2 |
| Molecular Weight | 514.59 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | 3-[[4-(2-cyanopyrrolidin-1-yl)-6-methoxy-1,3,5-triazin-2-yl]amino]-6,6-dimethyl-N-(2-phenylcyclopropyl)-1,4-dihydropyrrolo[3,4-d]pyrazole-5-carboxamide |
| SMILES | COc1nc(Nc2n[nH]c3c2CN(C(=O)NC2CC2c2ccccc2)C3(C)C)nc(N2CCCC2C#N)n1 |
| InChI | InChI=1S/C26H30N10O2/c1-26(2)20-18(14-36(26)25(37)28-19-12-17(19)15-8-5-4-6-9-15)21(34-33-20)29-22-30-23(32-24(31-22)38-3)35-11-7-10-16(35)13-27/h4-6,8-9,16-17,19H,7,10-12,14H2,1-3H3,(H,28,37)(H2,29,30,31,32,33,34) |
| InChIKey | DIJBNVANXQAKQG-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 147.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.59 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |