C24H26B3ClF2N6O5S2 — CID 159400416
N-[2-(6-chloro-5-fluoro-3-pyridinyl)-1,3-thiazol-4-yl]acetamide;N-[2-(5-fluoro-6-methyl-3-pyridinyl)-1,3-thiazol-4-yl]acetamide;2,4,6-trimethyl-1,3,5,2,4,6-trioxatriborinane (PubChem CID 159400416) has the molecular formula C24H26B3ClF2N6O5S2 and a molecular weight of 648.53 g/mol. Its IUPAC name is N-[2-(6-chloro-5-fluoro-3-pyridinyl)-1,3-thiazol-4-yl]acetamide;N-[2-(5-fluoro-6-methyl-3-pyridinyl)-1,3-thiazol-4-yl]acetamide;2,4,6-trimethyl-1,3,5,2,4,6-trioxatriborinane.
| Compound Name | N-[2-(6-chloro-5-fluoro-3-pyridinyl)-1,3-thiazol-4-yl]acetamide;N-[2-(5-fluoro-6-methyl-3-pyridinyl)-1,3-thiazol-4-yl]acetamide;2,4,6-trimethyl-1,3,5,2,4,6-trioxatriborinane |
|---|---|
| PubChem CID | 159400416 |
| Molecular Formula | C24H26B3ClF2N6O5S2 |
| Molecular Weight | 648.53 g/mol |
| Exact Mass | 648.13 |
| IUPAC Name | N-[2-(6-chloro-5-fluoro-3-pyridinyl)-1,3-thiazol-4-yl]acetamide;N-[2-(5-fluoro-6-methyl-3-pyridinyl)-1,3-thiazol-4-yl]acetamide;2,4,6-trimethyl-1,3,5,2,4,6-trioxatriborinane |
| SMILES | CB1OB(C)OB(C)O1.CC(=O)Nc1csc(-c2cnc(C)c(F)c2)n1.CC(=O)Nc1csc(-c2cnc(Cl)c(F)c2)n1 |
| InChI | InChI=1S/C11H10FN3OS.C10H7ClFN3OS.C3H9B3O3/c1-6-9(12)3-8(4-13-6)11-15-10(5-17-11)14-7(2)16;1-5(16)14-8-4-17-10(15-8)6-2-7(12)9(11)13-3-6;1-4-7-5(2)9-6(3)8-4/h3-5H,1-2H3,(H,14,16);2-4H,1H3,(H,14,16);1-3H3 |
| InChIKey | LNGOTPXMXGDJIT-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 137.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.53 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|