C16H12ClFN2OS2 — CID 174347209
(4-chloro-2-fluoro-5-methylphenyl)-oxido-[(2-phenyl-1,3-thiazol-4-yl)amino]sulfanium (PubChem CID 174347209) has the molecular formula C16H12ClFN2OS2 and a molecular weight of 366.87 g/mol. Its IUPAC name is (4-chloro-2-fluoro-5-methylphenyl)-oxido-[(2-phenyl-1,3-thiazol-4-yl)amino]sulfanium.
| Compound Name | (4-chloro-2-fluoro-5-methylphenyl)-oxido-[(2-phenyl-1,3-thiazol-4-yl)amino]sulfanium |
|---|---|
| PubChem CID | 174347209 |
| Molecular Formula | C16H12ClFN2OS2 |
| Molecular Weight | 366.87 g/mol |
| Exact Mass | 366.01 |
| IUPAC Name | (4-chloro-2-fluoro-5-methylphenyl)-oxido-[(2-phenyl-1,3-thiazol-4-yl)amino]sulfanium |
| SMILES | Cc1cc([S+]([O-])Nc2csc(-c3ccccc3)n2)c(F)cc1Cl |
| InChI | InChI=1S/C16H12ClFN2OS2/c1-10-7-14(13(18)8-12(10)17)23(21)20-15-9-22-16(19-15)11-5-3-2-4-6-11/h2-9,20H,1H3 |
| InChIKey | FFADZJPDRXRDSD-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 47.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.87 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|