C13H12Cl2N2OS — CID 177178454
N-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]-2-methylpropanamide (PubChem CID 177178454) has the molecular formula C13H12Cl2N2OS and a molecular weight of 315.23 g/mol. Its IUPAC name is N-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]-2-methylpropanamide.
| Compound Name | N-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 177178454 |
| Molecular Formula | C13H12Cl2N2OS |
| Molecular Weight | 315.23 g/mol |
| Exact Mass | 314.00 |
| IUPAC Name | N-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)Nc1csc(-c2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C13H12Cl2N2OS/c1-7(2)12(18)16-11-6-19-13(17-11)8-3-4-9(14)10(15)5-8/h3-7H,1-2H3,(H,16,18) |
| InChIKey | IRRXUZPKZMORSE-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.23 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |