C14H13Cl2N3O2S — CID 177062025
N-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]morpholine-2-carboxamide (PubChem CID 177062025) has the molecular formula C14H13Cl2N3O2S and a molecular weight of 358.25 g/mol. Its IUPAC name is N-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]morpholine-2-carboxamide.
| Compound Name | N-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]morpholine-2-carboxamide |
|---|---|
| PubChem CID | 177062025 |
| Molecular Formula | C14H13Cl2N3O2S |
| Molecular Weight | 358.25 g/mol |
| Exact Mass | 357.01 |
| IUPAC Name | N-[2-(3,4-dichlorophenyl)-1,3-thiazol-4-yl]morpholine-2-carboxamide |
| SMILES | O=C(Nc1csc(-c2ccc(Cl)c(Cl)c2)n1)C1CNCCO1 |
| InChI | InChI=1S/C14H13Cl2N3O2S/c15-9-2-1-8(5-10(9)16)14-19-12(7-22-14)18-13(20)11-6-17-3-4-21-11/h1-2,5,7,11,17H,3-4,6H2,(H,18,20) |
| InChIKey | JDQMVENRPWNSFG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.25 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |