C11H11ClN4O2S — CID 65476082
N-(5-chloro-2,1,3-benzothiadiazol-4-yl)morpholine-2-carboxamide (PubChem CID 65476082) has the molecular formula C11H11ClN4O2S and a molecular weight of 298.75 g/mol. Its IUPAC name is N-(5-chloro-2,1,3-benzothiadiazol-4-yl)morpholine-2-carboxamide.
| Compound Name | N-(5-chloro-2,1,3-benzothiadiazol-4-yl)morpholine-2-carboxamide |
|---|---|
| PubChem CID | 65476082 |
| Molecular Formula | C11H11ClN4O2S |
| Molecular Weight | 298.75 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | N-(5-chloro-2,1,3-benzothiadiazol-4-yl)morpholine-2-carboxamide |
| SMILES | O=C(Nc1c(Cl)ccc2nsnc12)C1CNCCO1 |
| InChI | InChI=1S/C11H11ClN4O2S/c12-6-1-2-7-10(16-19-15-7)9(6)14-11(17)8-5-13-3-4-18-8/h1-2,8,13H,3-5H2,(H,14,17) |
| InChIKey | XLMZEACHYJFNJA-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.75 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |