C20H18F3N3O4 — CID 159403447
(3R,4R)-1-methyl-N-(4-methyl-2-nitrophenyl)-2-oxo-4-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide (PubChem CID 159403447) has the molecular formula C20H18F3N3O4 and a molecular weight of 421.38 g/mol. Its IUPAC name is (3R,4R)-1-methyl-N-(4-methyl-2-nitrophenyl)-2-oxo-4-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide.
| Compound Name | (3R,4R)-1-methyl-N-(4-methyl-2-nitrophenyl)-2-oxo-4-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 159403447 |
| Molecular Formula | C20H18F3N3O4 |
| Molecular Weight | 421.38 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | (3R,4R)-1-methyl-N-(4-methyl-2-nitrophenyl)-2-oxo-4-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)[C@@H]2C(=O)N(C)C[C@H]2c2ccc(C(F)(F)F)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H18F3N3O4/c1-11-3-8-15(16(9-11)26(29)30)24-18(27)17-14(10-25(2)19(17)28)12-4-6-13(7-5-12)20(21,22)23/h3-9,14,17H,10H2,1-2H3,(H,24,27)/t14-,17+/m0/s1 |
| InChIKey | RFDOAYADEBMNMT-WMLDXEAASA-N |
| XLogP | 3.73 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.38 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|