C14H28O10 — CID 159406025
(2S,4R,5S)-6-ethyloxane-2,3,4,5-tetrol;(3R,4R)-2,3,4,5-tetrahydroxyheptanal (PubChem CID 159406025) has the molecular formula C14H28O10 and a molecular weight of 356.37 g/mol. Its IUPAC name is (2S,4R,5S)-6-ethyloxane-2,3,4,5-tetrol;(3R,4R)-2,3,4,5-tetrahydroxyheptanal.
| Compound Name | (2S,4R,5S)-6-ethyloxane-2,3,4,5-tetrol;(3R,4R)-2,3,4,5-tetrahydroxyheptanal |
|---|---|
| PubChem CID | 159406025 |
| Molecular Formula | C14H28O10 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | (2S,4R,5S)-6-ethyloxane-2,3,4,5-tetrol;(3R,4R)-2,3,4,5-tetrahydroxyheptanal |
| SMILES | CCC(O)[C@@H](O)[C@@H](O)C(O)C=O.CCC1O[C@H](O)C(O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/2C7H14O5/c1-2-3-4(8)5(9)6(10)7(11)12-3;1-2-4(9)6(11)7(12)5(10)3-8/h3-11H,2H2,1H3;3-7,9-12H,2H2,1H3/t3?,4-,5-,6?,7+;4?,5?,6-,7+/m11/s1 |
| InChIKey | LNYPDUUSZIBWDN-YGWWLSOHSA-N |
| XLogP | -3.76 |
| TPSA | 188.14 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | -3.76 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|