C12H25O15P — CID 174866109
(3R,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol;[(2R,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] dihydrogen phosphate (PubChem CID 174866109) has the molecular formula C12H25O15P and a molecular weight of 440.29 g/mol. Its IUPAC name is (3R,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol;[(2R,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] dihydrogen phosphate.
| Compound Name | (3R,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol;[(2R,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 174866109 |
| Molecular Formula | C12H25O15P |
| Molecular Weight | 440.29 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | (3R,4S,5S,6R)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol;[(2R,3S,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] dihydrogen phosphate |
| SMILES | O=C[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)COP(=O)(O)O.OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H13O9P.C6H12O6/c7-1-3(8)5(10)6(11)4(9)2-15-16(12,13)14;7-1-2-3(8)4(9)5(10)6(11)12-2/h1,3-6,8-11H,2H2,(H2,12,13,14);2-11H,1H2/t3-,4+,5+,6-;2-,3-,4+,5-,6?/m01/s1 |
| InChIKey | RNFYTJNTXLUEQQ-ORRSWSTOSA-N |
| XLogP | -6.48 |
| TPSA | 275.13 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.29 |
| LogP ≤ 5 | -6.48 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|