C11H21O13P — CID 175427199
[6-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,3,4,5-tetrahydroxy-6-oxohexyl] dihydrogen phosphate (PubChem CID 175427199) has the molecular formula C11H21O13P and a molecular weight of 392.25 g/mol. Its IUPAC name is [6-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,3,4,5-tetrahydroxy-6-oxohexyl] dihydrogen phosphate.
| Compound Name | [6-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,3,4,5-tetrahydroxy-6-oxohexyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 175427199 |
| Molecular Formula | C11H21O13P |
| Molecular Weight | 392.25 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | [6-[(3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,3,4,5-tetrahydroxy-6-oxohexyl] dihydrogen phosphate |
| SMILES | O=C(C(O)C(O)C(O)C(O)COP(=O)(O)O)C1O[C@H](CO)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C11H21O13P/c12-1-4-6(15)9(18)11(24-4)10(19)8(17)7(16)5(14)3(13)2-23-25(20,21)22/h3-9,11-18H,1-2H2,(H2,20,21,22)/t3?,4-,5?,6-,7?,8?,9-,11?/m1/s1 |
| InChIKey | SQGDPZWKGOJXHS-HOIYOPHQSA-N |
| XLogP | -5.41 |
| TPSA | 234.67 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.25 |
| LogP ≤ 5 | -5.41 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|