C34H42BBrN6O10 — CID 159407249
1-bromo-4-nitrobenzene;tert-butyl 4-(4-nitrophenyl)pyrazole-1-carboxylate;tert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole-1-carboxylate (PubChem CID 159407249) has the molecular formula C34H42BBrN6O10 and a molecular weight of 785.46 g/mol. Its IUPAC name is 1-bromo-4-nitrobenzene;tert-butyl 4-(4-nitrophenyl)pyrazole-1-carboxylate;tert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole-1-carboxylate.
| Compound Name | 1-bromo-4-nitrobenzene;tert-butyl 4-(4-nitrophenyl)pyrazole-1-carboxylate;tert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole-1-carboxylate |
|---|---|
| PubChem CID | 159407249 |
| Molecular Formula | C34H42BBrN6O10 |
| Molecular Weight | 785.46 g/mol |
| Exact Mass | 784.22 |
| IUPAC Name | 1-bromo-4-nitrobenzene;tert-butyl 4-(4-nitrophenyl)pyrazole-1-carboxylate;tert-butyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(-c2ccc([N+](=O)[O-])cc2)cn1.CC(C)(C)OC(=O)n1cc(B2OC(C)(C)C(C)(C)O2)cn1.O=[N+]([O-])c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H23BN2O4.C14H15N3O4.C6H4BrNO2/c1-12(2,3)19-11(18)17-9-10(8-16-17)15-20-13(4,5)14(6,7)21-15;1-14(2,3)21-13(18)16-9-11(8-15-16)10-4-6-12(7-5-10)17(19)20;7-5-1-3-6(4-2-5)8(9)10/h8-9H,1-7H3;4-9H,1-3H3;1-4H |
| InChIKey | LOCQBJLPRPRPDP-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 192.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.46 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|