C38H54BBrN6O6 — CID 143461157
tert-butyl N-[3-(4-bromo-1-methylpyrazol-3-yl)phenyl]carbamate;tert-butyl N-[3-[1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-3-yl]phenyl]carbamate;ethane (PubChem CID 143461157) has the molecular formula C38H54BBrN6O6 and a molecular weight of 781.60 g/mol. Its IUPAC name is tert-butyl N-[3-(4-bromo-1-methylpyrazol-3-yl)phenyl]carbamate;tert-butyl N-[3-[1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-3-yl]phenyl]carbamate;ethane.
| Compound Name | tert-butyl N-[3-(4-bromo-1-methylpyrazol-3-yl)phenyl]carbamate;tert-butyl N-[3-[1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-3-yl]phenyl]carbamate;ethane |
|---|---|
| PubChem CID | 143461157 |
| Molecular Formula | C38H54BBrN6O6 |
| Molecular Weight | 781.60 g/mol |
| Exact Mass | 780.34 |
| IUPAC Name | tert-butyl N-[3-(4-bromo-1-methylpyrazol-3-yl)phenyl]carbamate;tert-butyl N-[3-[1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-3-yl]phenyl]carbamate;ethane |
| SMILES | CC.Cn1cc(B2OC(C)(C)C(C)(C)O2)c(-c2cccc(NC(=O)OC(C)(C)C)c2)n1.Cn1cc(Br)c(-c2cccc(NC(=O)OC(C)(C)C)c2)n1 |
| InChI | InChI=1S/C21H30BN3O4.C15H18BrN3O2.C2H6/c1-19(2,3)27-18(26)23-15-11-9-10-14(12-15)17-16(13-25(8)24-17)22-28-20(4,5)21(6,7)29-22;1-15(2,3)21-14(20)17-11-7-5-6-10(8-11)13-12(16)9-19(4)18-13;1-2/h9-13H,1-8H3,(H,23,26);5-9H,1-4H3,(H,17,20);1-2H3 |
| InChIKey | LHHVQGAEQRMIFE-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 130.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.60 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|