C26H34BBrN6O2 — CID 159118213
3-bromoaniline;3-(1-methylpyrazol-4-yl)aniline;1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (PubChem CID 159118213) has the molecular formula C26H34BBrN6O2 and a molecular weight of 553.31 g/mol. Its IUPAC name is 3-bromoaniline;3-(1-methylpyrazol-4-yl)aniline;1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole.
| Compound Name | 3-bromoaniline;3-(1-methylpyrazol-4-yl)aniline;1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
|---|---|
| PubChem CID | 159118213 |
| Molecular Formula | C26H34BBrN6O2 |
| Molecular Weight | 553.31 g/mol |
| Exact Mass | 552.20 |
| IUPAC Name | 3-bromoaniline;3-(1-methylpyrazol-4-yl)aniline;1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| SMILES | Cn1cc(-c2cccc(N)c2)cn1.Cn1cc(B2OC(C)(C)C(C)(C)O2)cn1.Nc1cccc(Br)c1 |
| InChI | InChI=1S/C10H17BN2O2.C10H11N3.C6H6BrN/c1-9(2)10(3,4)15-11(14-9)8-6-12-13(5)7-8;1-13-7-9(6-12-13)8-3-2-4-10(11)5-8;7-5-2-1-3-6(8)4-5/h6-7H,1-5H3;2-7H,11H2,1H3;1-4H,8H2 |
| InChIKey | KFISVBYJQHKTSR-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 106.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.31 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|