C28H32BBrF6N6O2 — CID 157275260
2-bromo-4-(trifluoromethyl)aniline;2-(2-methylpyrazol-3-yl)-4-(trifluoromethyl)aniline;1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (PubChem CID 157275260) has the molecular formula C28H32BBrF6N6O2 and a molecular weight of 689.31 g/mol. Its IUPAC name is 2-bromo-4-(trifluoromethyl)aniline;2-(2-methylpyrazol-3-yl)-4-(trifluoromethyl)aniline;1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole.
| Compound Name | 2-bromo-4-(trifluoromethyl)aniline;2-(2-methylpyrazol-3-yl)-4-(trifluoromethyl)aniline;1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
|---|---|
| PubChem CID | 157275260 |
| Molecular Formula | C28H32BBrF6N6O2 |
| Molecular Weight | 689.31 g/mol |
| Exact Mass | 688.18 |
| IUPAC Name | 2-bromo-4-(trifluoromethyl)aniline;2-(2-methylpyrazol-3-yl)-4-(trifluoromethyl)aniline;1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| SMILES | Cn1nccc1-c1cc(C(F)(F)F)ccc1N.Cn1nccc1B1OC(C)(C)C(C)(C)O1.Nc1ccc(C(F)(F)F)cc1Br |
| InChI | InChI=1S/C11H10F3N3.C10H17BN2O2.C7H5BrF3N/c1-17-10(4-5-16-17)8-6-7(11(12,13)14)2-3-9(8)15;1-9(2)10(3,4)15-11(14-9)8-6-7-12-13(8)5;8-5-3-4(7(9,10)11)1-2-6(5)12/h2-6H,15H2,1H3;6-7H,1-5H3;1-3H,12H2 |
| InChIKey | AZAFIPAAPCGKMK-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 106.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.31 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|