C28H28BBr2F6IN4O2 — CID 161118702
1-bromo-2-iodo-4-(trifluoromethyl)benzene;5-[2-bromo-5-(trifluoromethyl)phenyl]-1-methylpyrazole;1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (PubChem CID 161118702) has the molecular formula C28H28BBr2F6IN4O2 and a molecular weight of 864.07 g/mol. Its IUPAC name is 1-bromo-2-iodo-4-(trifluoromethyl)benzene;5-[2-bromo-5-(trifluoromethyl)phenyl]-1-methylpyrazole;1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole.
| Compound Name | 1-bromo-2-iodo-4-(trifluoromethyl)benzene;5-[2-bromo-5-(trifluoromethyl)phenyl]-1-methylpyrazole;1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
|---|---|
| PubChem CID | 161118702 |
| Molecular Formula | C28H28BBr2F6IN4O2 |
| Molecular Weight | 864.07 g/mol |
| Exact Mass | 861.96 |
| IUPAC Name | 1-bromo-2-iodo-4-(trifluoromethyl)benzene;5-[2-bromo-5-(trifluoromethyl)phenyl]-1-methylpyrazole;1-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| SMILES | Cn1nccc1-c1cc(C(F)(F)F)ccc1Br.Cn1nccc1B1OC(C)(C)C(C)(C)O1.FC(F)(F)c1ccc(Br)c(I)c1 |
| InChI | InChI=1S/C11H8BrF3N2.C10H17BN2O2.C7H3BrF3I/c1-17-10(4-5-16-17)8-6-7(11(13,14)15)2-3-9(8)12;1-9(2)10(3,4)15-11(14-9)8-6-7-12-13(8)5;8-5-2-1-4(3-6(5)12)7(9,10)11/h2-6H,1H3;6-7H,1-5H3;1-3H |
| InChIKey | UKQVWHWYVNFGQA-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 54.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 864.07 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|