C32H48BBrN6O4P2 — CID 167690496
4-bromo-2-dimethylphosphorylaniline;2-dimethylphosphoryl-4-(1,4-dimethylpyrazol-5-yl)aniline;1,4-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (PubChem CID 167690496) has the molecular formula C32H48BBrN6O4P2 and a molecular weight of 733.44 g/mol. Its IUPAC name is 4-bromo-2-dimethylphosphorylaniline;2-dimethylphosphoryl-4-(1,4-dimethylpyrazol-5-yl)aniline;1,4-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole.
| Compound Name | 4-bromo-2-dimethylphosphorylaniline;2-dimethylphosphoryl-4-(1,4-dimethylpyrazol-5-yl)aniline;1,4-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
|---|---|
| PubChem CID | 167690496 |
| Molecular Formula | C32H48BBrN6O4P2 |
| Molecular Weight | 733.44 g/mol |
| Exact Mass | 732.25 |
| IUPAC Name | 4-bromo-2-dimethylphosphorylaniline;2-dimethylphosphoryl-4-(1,4-dimethylpyrazol-5-yl)aniline;1,4-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| SMILES | CP(C)(=O)c1cc(Br)ccc1N.Cc1cnn(C)c1-c1ccc(N)c(P(C)(C)=O)c1.Cc1cnn(C)c1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C13H18N3OP.C11H19BN2O2.C8H11BrNOP/c1-9-8-15-16(2)13(9)10-5-6-11(14)12(7-10)18(3,4)17;1-8-7-13-14(6)9(8)12-15-10(2,3)11(4,5)16-12;1-12(2,11)8-5-6(9)3-4-7(8)10/h5-8H,14H2,1-4H3;7H,1-6H3;3-5H,10H2,1-2H3 |
| InChIKey | WWCVBVCJDJSVLN-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 140.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.44 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|