C16H19BrFN3O2 — CID 66729611
tert-butyl N-[3-(4-bromo-1-ethylpyrazol-3-yl)-2-fluorophenyl]carbamate (PubChem CID 66729611) has the molecular formula C16H19BrFN3O2 and a molecular weight of 384.25 g/mol. Its IUPAC name is tert-butyl N-[3-(4-bromo-1-ethylpyrazol-3-yl)-2-fluorophenyl]carbamate.
| Compound Name | tert-butyl N-[3-(4-bromo-1-ethylpyrazol-3-yl)-2-fluorophenyl]carbamate |
|---|---|
| PubChem CID | 66729611 |
| Molecular Formula | C16H19BrFN3O2 |
| Molecular Weight | 384.25 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | tert-butyl N-[3-(4-bromo-1-ethylpyrazol-3-yl)-2-fluorophenyl]carbamate |
| SMILES | CCn1cc(Br)c(-c2cccc(NC(=O)OC(C)(C)C)c2F)n1 |
| InChI | InChI=1S/C16H19BrFN3O2/c1-5-21-9-11(17)14(20-21)10-7-6-8-12(13(10)18)19-15(22)23-16(2,3)4/h6-9H,5H2,1-4H3,(H,19,22) |
| InChIKey | YOUQUNBLVGHDFW-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.25 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |