C36H46BBrN6O6 — CID 143464979
tert-butyl N-[[4-bromo-3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-1H-pyrazol-5-yl]methyl]-N-[3-[1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-3-yl]phenyl]carbamate (PubChem CID 143464979) has the molecular formula C36H46BBrN6O6 and a molecular weight of 749.52 g/mol. Its IUPAC name is tert-butyl N-[[4-bromo-3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-1H-pyrazol-5-yl]methyl]-N-[3-[1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-3-yl]phenyl]carbamate.
| Compound Name | tert-butyl N-[[4-bromo-3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-1H-pyrazol-5-yl]methyl]-N-[3-[1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-3-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 143464979 |
| Molecular Formula | C36H46BBrN6O6 |
| Molecular Weight | 749.52 g/mol |
| Exact Mass | 748.28 |
| IUPAC Name | tert-butyl N-[[4-bromo-3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-1H-pyrazol-5-yl]methyl]-N-[3-[1-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-3-yl]phenyl]carbamate |
| SMILES | Cn1cc(B2OC(C)(C)C(C)(C)O2)c(-c2cccc(N(Cc3[nH]nc(-c4cccc(NC(=O)OC(C)(C)C)c4)c3Br)C(=O)OC(C)(C)C)c2)n1 |
| InChI | InChI=1S/C36H46BBrN6O6/c1-33(2,3)47-31(45)39-24-16-12-14-22(18-24)30-28(38)27(40-41-30)21-44(32(46)48-34(4,5)6)25-17-13-15-23(19-25)29-26(20-43(11)42-29)37-49-35(7,8)36(9,10)50-37/h12-20H,21H2,1-11H3,(H,39,45)(H,40,41) |
| InChIKey | LGYNSVYSYDFAKU-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 132.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.52 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|