C38H55BBrN5O4 — CID 159654788
tert-butyl N-[(1S)-1-(4-bromophenyl)ethyl]carbamate;1,4-dimethyl-5-(4-propan-2-ylphenyl)pyrazole;1,4-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (PubChem CID 159654788) has the molecular formula C38H55BBrN5O4 and a molecular weight of 736.61 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-(4-bromophenyl)ethyl]carbamate;1,4-dimethyl-5-(4-propan-2-ylphenyl)pyrazole;1,4-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole.
| Compound Name | tert-butyl N-[(1S)-1-(4-bromophenyl)ethyl]carbamate;1,4-dimethyl-5-(4-propan-2-ylphenyl)pyrazole;1,4-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
|---|---|
| PubChem CID | 159654788 |
| Molecular Formula | C38H55BBrN5O4 |
| Molecular Weight | 736.61 g/mol |
| Exact Mass | 735.35 |
| IUPAC Name | tert-butyl N-[(1S)-1-(4-bromophenyl)ethyl]carbamate;1,4-dimethyl-5-(4-propan-2-ylphenyl)pyrazole;1,4-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| SMILES | C[C@H](NC(=O)OC(C)(C)C)c1ccc(Br)cc1.Cc1cnn(C)c1-c1ccc(C(C)C)cc1.Cc1cnn(C)c1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C14H18N2.C13H18BrNO2.C11H19BN2O2/c1-10(2)12-5-7-13(8-6-12)14-11(3)9-15-16(14)4;1-9(10-5-7-11(14)8-6-10)15-12(16)17-13(2,3)4;1-8-7-13-14(6)9(8)12-15-10(2,3)11(4,5)16-12/h5-10H,1-4H3;5-9H,1-4H3,(H,15,16);7H,1-6H3/t;9-;/m.0./s1 |
| InChIKey | MSANPLLLLMZZLG-QKWFRNNBSA-N |
| XLogP | 8.58 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.61 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|