C30H36BBrN4O5 — CID 159770815
tert-butyl N-[3-[(5-bromo-2-oxo-1-pyridinyl)methyl]phenyl]carbamate;6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole (PubChem CID 159770815) has the molecular formula C30H36BBrN4O5 and a molecular weight of 623.36 g/mol. Its IUPAC name is tert-butyl N-[3-[(5-bromo-2-oxo-1-pyridinyl)methyl]phenyl]carbamate;6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole.
| Compound Name | tert-butyl N-[3-[(5-bromo-2-oxo-1-pyridinyl)methyl]phenyl]carbamate;6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole |
|---|---|
| PubChem CID | 159770815 |
| Molecular Formula | C30H36BBrN4O5 |
| Molecular Weight | 623.36 g/mol |
| Exact Mass | 622.20 |
| IUPAC Name | tert-butyl N-[3-[(5-bromo-2-oxo-1-pyridinyl)methyl]phenyl]carbamate;6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(Cn2cc(Br)ccc2=O)c1.CC1(C)OB(c2ccc3cn[nH]c3c2)OC1(C)C |
| InChI | InChI=1S/C17H19BrN2O3.C13H17BN2O2/c1-17(2,3)23-16(22)19-14-6-4-5-12(9-14)10-20-11-13(18)7-8-15(20)21;1-12(2)13(3,4)18-14(17-12)10-6-5-9-8-15-16-11(9)7-10/h4-9,11H,10H2,1-3H3,(H,19,22);5-8H,1-4H3,(H,15,16) |
| InChIKey | NGBYTIXILOJXPM-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 107.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.36 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|