C27H33BBrN5O5 — CID 159918774
tert-butyl 4-[(5-bromo-2-oxo-1-pyridinyl)methyl]pyrazole-1-carboxylate;6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole (PubChem CID 159918774) has the molecular formula C27H33BBrN5O5 and a molecular weight of 598.31 g/mol. Its IUPAC name is tert-butyl 4-[(5-bromo-2-oxo-1-pyridinyl)methyl]pyrazole-1-carboxylate;6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole.
| Compound Name | tert-butyl 4-[(5-bromo-2-oxo-1-pyridinyl)methyl]pyrazole-1-carboxylate;6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole |
|---|---|
| PubChem CID | 159918774 |
| Molecular Formula | C27H33BBrN5O5 |
| Molecular Weight | 598.31 g/mol |
| Exact Mass | 597.18 |
| IUPAC Name | tert-butyl 4-[(5-bromo-2-oxo-1-pyridinyl)methyl]pyrazole-1-carboxylate;6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole |
| SMILES | CC(C)(C)OC(=O)n1cc(Cn2cc(Br)ccc2=O)cn1.CC1(C)OB(c2ccc3cn[nH]c3c2)OC1(C)C |
| InChI | InChI=1S/C14H16BrN3O3.C13H17BN2O2/c1-14(2,3)21-13(20)18-8-10(6-16-18)7-17-9-11(15)4-5-12(17)19;1-12(2)13(3,4)18-14(17-12)10-6-5-9-8-15-16-11(9)7-10/h4-6,8-9H,7H2,1-3H3;5-8H,1-4H3,(H,15,16) |
| InChIKey | NYDBNFNOCGOHEO-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 113.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.31 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|