C31H41N7O4 — CID 160856131
tert-butyl N-[methyl-(1-methyl-3-phenylpyrazol-4-yl)amino]carbamate;tert-butyl N-(1-methyl-3-phenylpyrazol-4-yl)carbamate (PubChem CID 160856131) has the molecular formula C31H41N7O4 and a molecular weight of 575.71 g/mol. Its IUPAC name is tert-butyl N-[methyl-(1-methyl-3-phenylpyrazol-4-yl)amino]carbamate;tert-butyl N-(1-methyl-3-phenylpyrazol-4-yl)carbamate.
| Compound Name | tert-butyl N-[methyl-(1-methyl-3-phenylpyrazol-4-yl)amino]carbamate;tert-butyl N-(1-methyl-3-phenylpyrazol-4-yl)carbamate |
|---|---|
| PubChem CID | 160856131 |
| Molecular Formula | C31H41N7O4 |
| Molecular Weight | 575.71 g/mol |
| Exact Mass | 575.32 |
| IUPAC Name | tert-butyl N-[methyl-(1-methyl-3-phenylpyrazol-4-yl)amino]carbamate;tert-butyl N-(1-methyl-3-phenylpyrazol-4-yl)carbamate |
| SMILES | CN(NC(=O)OC(C)(C)C)c1cn(C)nc1-c1ccccc1.Cn1cc(NC(=O)OC(C)(C)C)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C16H22N4O2.C15H19N3O2/c1-16(2,3)22-15(21)18-20(5)13-11-19(4)17-14(13)12-9-7-6-8-10-12;1-15(2,3)20-14(19)16-12-10-18(4)17-13(12)11-8-6-5-7-9-11/h6-11H,1-5H3,(H,18,21);5-10H,1-4H3,(H,16,19) |
| InChIKey | SJWPCXHCCCBAPJ-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 115.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.71 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|