C43H54O7Si — CID 15940738
[(2R,6S)-6-[(2S,5S,6S)-5,6-bis(4-methoxyphenyl)-3-methylidene-1,4-dioxan-2-yl]-6-(methoxymethoxy)hexan-2-yl]oxy-tert-butyl-diphenylsilane (PubChem CID 15940738) has the molecular formula C43H54O7Si and a molecular weight of 710.98 g/mol. Its IUPAC name is [(2R,6S)-6-[(2S,5S,6S)-5,6-bis(4-methoxyphenyl)-3-methylidene-1,4-dioxan-2-yl]-6-(methoxymethoxy)hexan-2-yl]oxy-tert-butyl-diphenylsilane.
| Compound Name | [(2R,6S)-6-[(2S,5S,6S)-5,6-bis(4-methoxyphenyl)-3-methylidene-1,4-dioxan-2-yl]-6-(methoxymethoxy)hexan-2-yl]oxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 15940738 |
| Molecular Formula | C43H54O7Si |
| Molecular Weight | 710.98 g/mol |
| Exact Mass | 710.36 |
| IUPAC Name | [(2R,6S)-6-[(2S,5S,6S)-5,6-bis(4-methoxyphenyl)-3-methylidene-1,4-dioxan-2-yl]-6-(methoxymethoxy)hexan-2-yl]oxy-tert-butyl-diphenylsilane |
| SMILES | C=C1O[C@@H](c2ccc(OC)cc2)[C@H](c2ccc(OC)cc2)O[C@H]1[C@H](CCC[C@@H](C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OCOC |
| InChI | InChI=1S/C43H54O7Si/c1-31(50-51(43(3,4)5,37-17-11-9-12-18-37)38-19-13-10-14-20-38)16-15-21-39(47-30-44-6)40-32(2)48-41(33-22-26-35(45-7)27-23-33)42(49-40)34-24-28-36(46-8)29-25-34/h9-14,17-20,22-29,31,39-42H,2,15-16,21,30H2,1,3-8H3/t31-,39+,40-,41+,42+/m1/s1 |
| InChIKey | HPRMDOAMTMXELW-DTPTVLEDSA-N |
| XLogP | 8.54 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.98 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|